C15H11Cl2FO — CID 68742879
3-(2,4-dichlorophenyl)-1-(4-fluorophenyl)propan-1-one (PubChem CID 68742879) has the molecular formula C15H11Cl2FO and a molecular weight of 297.16 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(4-fluorophenyl)propan-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 68742879 |
| Molecular Formula | C15H11Cl2FO |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(4-fluorophenyl)propan-1-one |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11Cl2FO/c16-12-5-1-10(14(17)9-12)4-8-15(19)11-2-6-13(18)7-3-11/h1-3,5-7,9H,4,8H2 |
| InChIKey | XDLZGIILBLJPME-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |