C17H21FO3 — CID 62029866
1-(3-fluoro-4-methoxyphenyl)-2-[(6-methylcyclohex-3-en-1-yl)methoxy]ethanone (PubChem CID 62029866) has the molecular formula C17H21FO3 and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-2-[(6-methylcyclohex-3-en-1-yl)methoxy]ethanone.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-2-[(6-methylcyclohex-3-en-1-yl)methoxy]ethanone |
|---|---|
| PubChem CID | 62029866 |
| Molecular Formula | C17H21FO3 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-2-[(6-methylcyclohex-3-en-1-yl)methoxy]ethanone |
| SMILES | COc1ccc(C(=O)COCC2CC=CCC2C)cc1F |
| InChI | InChI=1S/C17H21FO3/c1-12-5-3-4-6-14(12)10-21-11-16(19)13-7-8-17(20-2)15(18)9-13/h3-4,7-9,12,14H,5-6,10-11H2,1-2H3 |
| InChIKey | JFAFYPKWCYRRSF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|