C14H14N2O4S — CID 62032289
2-[2-[(2-methoxy-2-phenylacetyl)amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 62032289) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-[2-[(2-methoxy-2-phenylacetyl)amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(2-methoxy-2-phenylacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 62032289 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[2-[(2-methoxy-2-phenylacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COC(C(=O)Nc1nc(CC(=O)O)cs1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2O4S/c1-20-12(9-5-3-2-4-6-9)13(19)16-14-15-10(8-21-14)7-11(17)18/h2-6,8,12H,7H2,1H3,(H,17,18)(H,15,16,19) |
| InChIKey | QCGSYWZNLUPZSV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |