C13H16BrNO — CID 62035173
2-[(3-bromophenyl)methyl-methylamino]cyclopentan-1-one (PubChem CID 62035173) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-methylamino]cyclopentan-1-one.
| Compound Name | 2-[(3-bromophenyl)methyl-methylamino]cyclopentan-1-one |
|---|---|
| PubChem CID | 62035173 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-methylamino]cyclopentan-1-one |
| SMILES | CN(Cc1cccc(Br)c1)C1CCCC1=O |
| InChI | InChI=1S/C13H16BrNO/c1-15(12-6-3-7-13(12)16)9-10-4-2-5-11(14)8-10/h2,4-5,8,12H,3,6-7,9H2,1H3 |
| InChIKey | WHGKCRJMMWGMMV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |