C16H24BrNO3 — CID 62035204
1-(3-bromo-4-methoxyphenyl)-2-[2-hydroxyethyl(pentan-3-yl)amino]ethanone (PubChem CID 62035204) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-2-[2-hydroxyethyl(pentan-3-yl)amino]ethanone.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-2-[2-hydroxyethyl(pentan-3-yl)amino]ethanone |
|---|---|
| PubChem CID | 62035204 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-2-[2-hydroxyethyl(pentan-3-yl)amino]ethanone |
| SMILES | CCC(CC)N(CCO)CC(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C16H24BrNO3/c1-4-13(5-2)18(8-9-19)11-15(20)12-6-7-16(21-3)14(17)10-12/h6-7,10,13,19H,4-5,8-9,11H2,1-3H3 |
| InChIKey | CDCPYPNBIKLGBU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |