C17H16N2OS — CID 62036459
4-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]acetyl]benzonitrile (PubChem CID 62036459) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is 4-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]acetyl]benzonitrile.
| Compound Name | 4-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]acetyl]benzonitrile |
|---|---|
| PubChem CID | 62036459 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]acetyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)CN(Cc2ccsc2)C2CC2)cc1 |
| InChI | InChI=1S/C17H16N2OS/c18-9-13-1-3-15(4-2-13)17(20)11-19(16-5-6-16)10-14-7-8-21-12-14/h1-4,7-8,12,16H,5-6,10-11H2 |
| InChIKey | JLMCBRJVDOFCIW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |