C16H19NO4 — CID 62042889
1-(2-butoxyethyl)-2-oxoquinoline-4-carboxylic acid (PubChem CID 62042889) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-2-oxoquinoline-4-carboxylic acid.
| Compound Name | 1-(2-butoxyethyl)-2-oxoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 62042889 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(2-butoxyethyl)-2-oxoquinoline-4-carboxylic acid |
| SMILES | CCCCOCCn1c(=O)cc(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C16H19NO4/c1-2-3-9-21-10-8-17-14-7-5-4-6-12(14)13(16(19)20)11-15(17)18/h4-7,11H,2-3,8-10H2,1H3,(H,19,20) |
| InChIKey | WVBNMVWJNOEDSA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|