C11H15BrN2O4S — CID 62043738
4-[(5-bromo-3-pyridinyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 62043738) has the molecular formula C11H15BrN2O4S and a molecular weight of 351.22 g/mol. Its IUPAC name is 4-[(5-bromo-3-pyridinyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 4-[(5-bromo-3-pyridinyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 62043738 |
| Molecular Formula | C11H15BrN2O4S |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 4-[(5-bromo-3-pyridinyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NS(=O)(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O4S/c1-11(2,4-3-10(15)16)14-19(17,18)9-5-8(12)6-13-7-9/h5-7,14H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | URLSJXPTWWVPDF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |