C14H17N3O3 — CID 62044906
N-[3-(5-oxo-1,4-diazepane-1-carbonyl)phenyl]acetamide (PubChem CID 62044906) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[3-(5-oxo-1,4-diazepane-1-carbonyl)phenyl]acetamide.
| Compound Name | N-[3-(5-oxo-1,4-diazepane-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 62044906 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[3-(5-oxo-1,4-diazepane-1-carbonyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(=O)N2CCNC(=O)CC2)c1 |
| InChI | InChI=1S/C14H17N3O3/c1-10(18)16-12-4-2-3-11(9-12)14(20)17-7-5-13(19)15-6-8-17/h2-4,9H,5-8H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | SDGXBFGZARBXRS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |