C12H13IN2O2 — CID 60707871
1-(3-iodobenzoyl)-1,4-diazepan-5-one (PubChem CID 60707871) has the molecular formula C12H13IN2O2 and a molecular weight of 344.15 g/mol. Its IUPAC name is 1-(3-iodobenzoyl)-1,4-diazepan-5-one.
| Compound Name | 1-(3-iodobenzoyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 60707871 |
| Molecular Formula | C12H13IN2O2 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 1-(3-iodobenzoyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)c2cccc(I)c2)CCN1 |
| InChI | InChI=1S/C12H13IN2O2/c13-10-3-1-2-9(8-10)12(17)15-6-4-11(16)14-5-7-15/h1-3,8H,4-7H2,(H,14,16) |
| InChIKey | BBVPNQREQQKZMP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|