About 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine
3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine (PubChem CID 162259871) has the molecular formula C22H26I2N2O5
and a molecular weight of 652.27 g/mol. Its IUPAC name is 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine.
Molecular Properties
| Compound Name | 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine |
| PubChem CID | 162259871 |
| Molecular Formula | C22H26I2N2O5 |
| Molecular Weight | 652.27 g/mol |
| Exact Mass | 651.99 |
| IUPAC Name | 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine |
| SMILES | C1COCCN1.O=C(O)c1cccc(I)c1.O=C(c1cccc(I)c1)N1CCOCC1 |
| InChI | InChI=1S/C11H12INO2.C7H5IO2.C4H9NO/c12-10-3-1-2-9(8-10)11(14)13-4-6-15-7-5-13;8-6-3-1-2-5(4-6)7(9)10;1-3-6-4-2-5-1/h1-3,8H,4-7H2;1-4H,(H,9,10);5H,1-4H2 |
| InChIKey | ZZCCEHQVOYBCIL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 652.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine?
The IUPAC name of 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine (CID 162259871) is 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine.
What is the SMILES notation for 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine?
The canonical SMILES for 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine is C1COCCN1.O=C(O)c1cccc(I)c1.O=C(c1cccc(I)c1)N1CCOCC1.
What is the InChIKey of 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine?
The InChIKey is ZZCCEHQVOYBCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12INO2.C7H5IO2.C4H9NO/c12-10-3-1-2-9(8-10)11(14)13-4-6-15-7-5-13;8-6-3-1-2-5(4-6)7(9)10;1-3-6-4-2-5-1/h1-3,8H,4-7H2;1-4H,(H,9,10);5H,1-4H2.
What are the key properties of 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine?
3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine has a molecular weight of 652.27 g/mol, XLogP of 3.36, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodobenzoic acid;(3-iodophenyl)-morpholin-4-ylmethanone;morpholine is sourced from PubChem (CID 162259871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).