C13H16N4O2S — CID 62047764
3-(3-oxo-3-piperazin-1-ylpropyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 62047764) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-(3-oxo-3-piperazin-1-ylpropyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3-oxo-3-piperazin-1-ylpropyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62047764 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-(3-oxo-3-piperazin-1-ylpropyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=C(CCn1cnc2sccc2c1=O)N1CCNCC1 |
| InChI | InChI=1S/C13H16N4O2S/c18-11(16-6-3-14-4-7-16)1-5-17-9-15-12-10(13(17)19)2-8-20-12/h2,8-9,14H,1,3-7H2 |
| InChIKey | SYWDKCZPWXOGCL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |