C12H16N4OS — CID 39746239
3-(2-piperazin-1-ylethyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 39746239) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-(2-piperazin-1-ylethyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-piperazin-1-ylethyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 39746239 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-(2-piperazin-1-ylethyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2ncn1CCN1CCNCC1 |
| InChI | InChI=1S/C12H16N4OS/c17-12-10-1-8-18-11(10)14-9-16(12)7-6-15-4-2-13-3-5-15/h1,8-9,13H,2-7H2 |
| InChIKey | QWXJWCHIBXLGNZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |