C11H14N4O2S — CID 63578956
5-(4-oxothieno[2,3-d]pyrimidin-3-yl)pentanehydrazide (PubChem CID 63578956) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 5-(4-oxothieno[2,3-d]pyrimidin-3-yl)pentanehydrazide.
| Compound Name | 5-(4-oxothieno[2,3-d]pyrimidin-3-yl)pentanehydrazide |
|---|---|
| PubChem CID | 63578956 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 5-(4-oxothieno[2,3-d]pyrimidin-3-yl)pentanehydrazide |
| SMILES | NNC(=O)CCCCn1cnc2sccc2c1=O |
| InChI | InChI=1S/C11H14N4O2S/c12-14-9(16)3-1-2-5-15-7-13-10-8(11(15)17)4-6-18-10/h4,6-7H,1-3,5,12H2,(H,14,16) |
| InChIKey | ULODHJRCBPMUKN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|