C11H13N3OS — CID 62564362
3-[2-(prop-2-enylamino)ethyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 62564362) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-[2-(prop-2-enylamino)ethyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(prop-2-enylamino)ethyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62564362 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-[2-(prop-2-enylamino)ethyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCNCCn1cnc2sccc2c1=O |
| InChI | InChI=1S/C11H13N3OS/c1-2-4-12-5-6-14-8-13-10-9(11(14)15)3-7-16-10/h2-3,7-8,12H,1,4-6H2 |
| InChIKey | KNUWKVOYFPBIKN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|