C13H12BrN3OS2 — CID 62562447
3-[2-[(4-bromothiophen-2-yl)methylamino]ethyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 62562447) has the molecular formula C13H12BrN3OS2 and a molecular weight of 370.30 g/mol. Its IUPAC name is 3-[2-[(4-bromothiophen-2-yl)methylamino]ethyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-[(4-bromothiophen-2-yl)methylamino]ethyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62562447 |
| Molecular Formula | C13H12BrN3OS2 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 3-[2-[(4-bromothiophen-2-yl)methylamino]ethyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2ncn1CCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C13H12BrN3OS2/c14-9-5-10(20-7-9)6-15-2-3-17-8-16-12-11(13(17)18)1-4-19-12/h1,4-5,7-8,15H,2-3,6H2 |
| InChIKey | PMWYPWDPKPWXRO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|