C15H11BrN2O3S — CID 24592470
(4-bromophenyl) 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate (PubChem CID 24592470) has the molecular formula C15H11BrN2O3S and a molecular weight of 379.24 g/mol. Its IUPAC name is (4-bromophenyl) 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate.
| Compound Name | (4-bromophenyl) 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate |
|---|---|
| PubChem CID | 24592470 |
| Molecular Formula | C15H11BrN2O3S |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | (4-bromophenyl) 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate |
| SMILES | O=C(CCn1cnc2sccc2c1=O)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H11BrN2O3S/c16-10-1-3-11(4-2-10)21-13(19)5-7-18-9-17-14-12(15(18)20)6-8-22-14/h1-4,6,8-9H,5,7H2 |
| InChIKey | RNKMEWCDWSYQMG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|