C11H11N5OS — CID 63316363
3-[2-(3-aminopyrazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 63316363) has the molecular formula C11H11N5OS and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-[2-(3-aminopyrazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(3-aminopyrazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 63316363 |
| Molecular Formula | C11H11N5OS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-[2-(3-aminopyrazol-1-yl)ethyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Nc1ccn(CCn2cnc3sccc3c2=O)n1 |
| InChI | InChI=1S/C11H11N5OS/c12-9-1-3-16(14-9)5-4-15-7-13-10-8(11(15)17)2-6-18-10/h1-3,6-7H,4-5H2,(H2,12,14) |
| InChIKey | AUMCFXSXNUFQKZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |