C15H19N3O4S — CID 119220091
6-[3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoylamino]hexanoic acid (PubChem CID 119220091) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 6-[3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoylamino]hexanoic acid.
| Compound Name | 6-[3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 119220091 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 6-[3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCn1cnc2sccc2c1=O |
| InChI | InChI=1S/C15H19N3O4S/c19-12(16-7-3-1-2-4-13(20)21)5-8-18-10-17-14-11(15(18)22)6-9-23-14/h6,9-10H,1-5,7-8H2,(H,16,19)(H,20,21) |
| InChIKey | BFBQVAUZFSQNKE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|