C12H15N3O2S — CID 9372669
N-butyl-2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 9372669) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is N-butyl-2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-butyl-2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 9372669 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-butyl-2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | CCCCNC(=O)Cn1cnc2sccc2c1=O |
| InChI | InChI=1S/C12H15N3O2S/c1-2-3-5-13-10(16)7-15-8-14-11-9(12(15)17)4-6-18-11/h4,6,8H,2-3,5,7H2,1H3,(H,13,16) |
| InChIKey | WAKADBRAGNIEGZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|