C14H17N3O4S — CID 18195399
ethyl 4-[[2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]butanoate (PubChem CID 18195399) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is ethyl 4-[[2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 18195399 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | ethyl 4-[[2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)Cn1cnc2sccc2c1=O |
| InChI | InChI=1S/C14H17N3O4S/c1-2-21-12(19)4-3-6-15-11(18)8-17-9-16-13-10(14(17)20)5-7-22-13/h5,7,9H,2-4,6,8H2,1H3,(H,15,18) |
| InChIKey | KKQFELZYNCEWRJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|