C13H15N3O4S2 — CID 119242258
2-[2-[3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoylamino]ethylsulfanyl]acetic acid (PubChem CID 119242258) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[2-[3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoylamino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoylamino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119242258 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[2-[3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanoylamino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)CCn1cnc2sccc2c1=O |
| InChI | InChI=1S/C13H15N3O4S2/c17-10(14-3-6-21-7-11(18)19)1-4-16-8-15-12-9(13(16)20)2-5-22-12/h2,5,8H,1,3-4,6-7H2,(H,14,17)(H,18,19) |
| InChIKey | BEOCCSKITMWUGN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|