About 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid (PubChem CID 62049092) has the molecular formula C9H17NO4S
and a molecular weight of 235.30 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid.
Analyze 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid?
The IUPAC name of 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid (CID 62049092) is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid.
What is the SMILES notation for 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid?
The canonical SMILES for 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid is CC(C)(CCC(=O)O)N1CCCS1(=O)=O.
What is the InChIKey of 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid?
The InChIKey is DPKRILXHVVVQLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4S/c1-9(2,5-4-8(11)12)10-6-3-7-15(10,13)14/h3-7H2,1-2H3,(H,11,12).
What are the key properties of 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid?
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid has a molecular weight of 235.30 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylpentanoic acid is sourced from PubChem (CID 62049092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).