3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid

C8H15NO4S — CID 64700411

IUPAC3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid
SMILESCC(C)(CC(=O)O)N1CCCS1(=O)=O
InChIInChI=1S/C8H15NO4S/c1-8(2,6-7(10)11)9-4-3-5-14(9,12)13/h3-6H2,1-2H3,(H,10,11)
InChIKeyXCNOHOIFYVLHCH-UHFFFAOYSA-N
MW221.28 g/mol
LogP0.28
Rot. Bonds3

About 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid

3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid (PubChem CID 64700411) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid.

Molecular Properties

Compound Name3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid
PubChem CID64700411
Molecular FormulaC8H15NO4S
Molecular Weight221.28 g/mol
Exact Mass221.07
IUPAC Name3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid
SMILESCC(C)(CC(=O)O)N1CCCS1(=O)=O
InChIInChI=1S/C8H15NO4S/c1-8(2,6-7(10)11)9-4-3-5-14(9,12)13/h3-6H2,1-2H3,(H,10,11)
InChIKeyXCNOHOIFYVLHCH-UHFFFAOYSA-N
XLogP0.28
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.28
LogP ≤ 50.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid?
The IUPAC name of 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid (CID 64700411) is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid.
What is the SMILES notation for 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid?
The canonical SMILES for 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid is CC(C)(CC(=O)O)N1CCCS1(=O)=O.
What is the InChIKey of 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid?
The InChIKey is XCNOHOIFYVLHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S/c1-8(2,6-7(10)11)9-4-3-5-14(9,12)13/h3-6H2,1-2H3,(H,10,11).
What are the key properties of 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid?
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid has a molecular weight of 221.28 g/mol, XLogP of 0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylbutanoic acid is sourced from PubChem (CID 64700411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).