C13H15BrN2O — CID 62050757
3-[[1-(4-bromophenyl)-1-oxopropan-2-yl]-methylamino]propanenitrile (PubChem CID 62050757) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 3-[[1-(4-bromophenyl)-1-oxopropan-2-yl]-methylamino]propanenitrile.
| Compound Name | 3-[[1-(4-bromophenyl)-1-oxopropan-2-yl]-methylamino]propanenitrile |
|---|---|
| PubChem CID | 62050757 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-[[1-(4-bromophenyl)-1-oxopropan-2-yl]-methylamino]propanenitrile |
| SMILES | CC(C(=O)c1ccc(Br)cc1)N(C)CCC#N |
| InChI | InChI=1S/C13H15BrN2O/c1-10(16(2)9-3-8-15)13(17)11-4-6-12(14)7-5-11/h4-7,10H,3,9H2,1-2H3 |
| InChIKey | SHTICTNCOUQZHZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |