C15H19BrN2O — CID 63222935
3-[[4-(4-bromophenyl)-4-oxobutyl]-methylamino]butanenitrile (PubChem CID 63222935) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is 3-[[4-(4-bromophenyl)-4-oxobutyl]-methylamino]butanenitrile.
| Compound Name | 3-[[4-(4-bromophenyl)-4-oxobutyl]-methylamino]butanenitrile |
|---|---|
| PubChem CID | 63222935 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 3-[[4-(4-bromophenyl)-4-oxobutyl]-methylamino]butanenitrile |
| SMILES | CC(CC#N)N(C)CCCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H19BrN2O/c1-12(9-10-17)18(2)11-3-4-15(19)13-5-7-14(16)8-6-13/h5-8,12H,3-4,9,11H2,1-2H3 |
| InChIKey | KPHOOERIZQMODJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |