C8H6BrN3O2S — CID 62059443
1-[(3-bromothiophen-2-yl)methyl]triazole-4-carboxylic acid (PubChem CID 62059443) has the molecular formula C8H6BrN3O2S and a molecular weight of 288.13 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62059443 |
| Molecular Formula | C8H6BrN3O2S |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2sccc2Br)nn1 |
| InChI | InChI=1S/C8H6BrN3O2S/c9-5-1-2-15-7(5)4-12-3-6(8(13)14)10-11-12/h1-3H,4H2,(H,13,14) |
| InChIKey | XZTXXEQTAWAVCD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |