C15H17BrN2O2 — CID 62061488
4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]-7-bromochromen-2-one (PubChem CID 62061488) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]-7-bromochromen-2-one.
| Compound Name | 4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]-7-bromochromen-2-one |
|---|---|
| PubChem CID | 62061488 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]-7-bromochromen-2-one |
| SMILES | NCC1CCN(Cc2cc(=O)oc3cc(Br)ccc23)C1 |
| InChI | InChI=1S/C15H17BrN2O2/c16-12-1-2-13-11(5-15(19)20-14(13)6-12)9-18-4-3-10(7-17)8-18/h1-2,5-6,10H,3-4,7-9,17H2 |
| InChIKey | LHAAKQCMPFTDNK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|