C20H20BrN3O3S — CID 55856760
1-[(7-bromo-2-oxochromen-4-yl)methyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 55856760) has the molecular formula C20H20BrN3O3S and a molecular weight of 462.37 g/mol. Its IUPAC name is 1-[(7-bromo-2-oxochromen-4-yl)methyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(7-bromo-2-oxochromen-4-yl)methyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55856760 |
| Molecular Formula | C20H20BrN3O3S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 1-[(7-bromo-2-oxochromen-4-yl)methyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | Cc1csc(NC(=O)C2CCN(Cc3cc(=O)oc4cc(Br)ccc34)CC2)n1 |
| InChI | InChI=1S/C20H20BrN3O3S/c1-12-11-28-20(22-12)23-19(26)13-4-6-24(7-5-13)10-14-8-18(25)27-17-9-15(21)2-3-16(14)17/h2-3,8-9,11,13H,4-7,10H2,1H3,(H,22,23,26) |
| InChIKey | IUHBVUFDKGMGAZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|