C10H18N4O2S — CID 62064635
N-(3-aminocyclobutyl)-1-ethyl-2-methylimidazole-4-sulfonamide (PubChem CID 62064635) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-1-ethyl-2-methylimidazole-4-sulfonamide.
| Compound Name | N-(3-aminocyclobutyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 62064635 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-(3-aminocyclobutyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC2CC(N)C2)nc1C |
| InChI | InChI=1S/C10H18N4O2S/c1-3-14-6-10(12-7(14)2)17(15,16)13-9-4-8(11)5-9/h6,8-9,13H,3-5,11H2,1-2H3 |
| InChIKey | SJVDBGFCXAZELZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |