C14H12BrN3O — CID 62065175
4-bromo-N-(5-cyano-2-methylphenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 62065175) has the molecular formula C14H12BrN3O and a molecular weight of 318.17 g/mol. Its IUPAC name is 4-bromo-N-(5-cyano-2-methylphenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(5-cyano-2-methylphenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62065175 |
| Molecular Formula | C14H12BrN3O |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-bromo-N-(5-cyano-2-methylphenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1ccc(C#N)cc1NC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C14H12BrN3O/c1-9-3-4-10(7-16)5-12(9)17-14(19)13-6-11(15)8-18(13)2/h3-6,8H,1-2H3,(H,17,19) |
| InChIKey | TZHKRXHHWCPSKY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |