C14H11BrClN3O — CID 103811088
4-bromo-N-(2-chloro-4-cyanophenyl)-1-ethylpyrrole-2-carboxamide (PubChem CID 103811088) has the molecular formula C14H11BrClN3O and a molecular weight of 352.62 g/mol. Its IUPAC name is 4-bromo-N-(2-chloro-4-cyanophenyl)-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2-chloro-4-cyanophenyl)-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103811088 |
| Molecular Formula | C14H11BrClN3O |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 4-bromo-N-(2-chloro-4-cyanophenyl)-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C14H11BrClN3O/c1-2-19-8-10(15)6-13(19)14(20)18-12-4-3-9(7-17)5-11(12)16/h3-6,8H,2H2,1H3,(H,18,20) |
| InChIKey | CVOQHPKQQQFJMB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |