C13H12BrN3O4 — CID 60954792
4-bromo-1-ethyl-N-(4-hydroxy-2-nitrophenyl)pyrrole-2-carboxamide (PubChem CID 60954792) has the molecular formula C13H12BrN3O4 and a molecular weight of 354.16 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-(4-hydroxy-2-nitrophenyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-(4-hydroxy-2-nitrophenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60954792 |
| Molecular Formula | C13H12BrN3O4 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 4-bromo-1-ethyl-N-(4-hydroxy-2-nitrophenyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1ccc(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12BrN3O4/c1-2-16-7-8(14)5-12(16)13(19)15-10-4-3-9(18)6-11(10)17(20)21/h3-7,18H,2H2,1H3,(H,15,19) |
| InChIKey | KQQRCSVBJWTWJV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|