C13H21N3O — CID 62065650
N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine (PubChem CID 62065650) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine.
| Compound Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 62065650 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine |
| SMILES | Cc1[nH]ncc1CCCNCC1CCC=CO1 |
| InChI | InChI=1S/C13H21N3O/c1-11-12(9-15-16-11)5-4-7-14-10-13-6-2-3-8-17-13/h3,8-9,13-14H,2,4-7,10H2,1H3,(H,15,16) |
| InChIKey | UGMJYYZLFYGZNG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|