methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate

C14H16FNO3 — CID 62065809

IUPACmethyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate
SMILESCOC(=O)c1cc(F)ccc1NCC1CCC=CO1
InChIInChI=1S/C14H16FNO3/c1-18-14(17)12-8-10(15)5-6-13(12)16-9-11-4-2-3-7-19-11/h3,5-8,11,16H,2,4,9H2,1H3
InChIKeyIWCRFTUJKHFAAS-UHFFFAOYSA-N
MW265.28 g/mol
LogP2.72
Rot. Bonds4

About methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate

methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate (PubChem CID 62065809) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate.

Molecular Properties

Compound Namemethyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate
PubChem CID62065809
Molecular FormulaC14H16FNO3
Molecular Weight265.28 g/mol
Exact Mass265.11
IUPAC Namemethyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate
SMILESCOC(=O)c1cc(F)ccc1NCC1CCC=CO1
InChIInChI=1S/C14H16FNO3/c1-18-14(17)12-8-10(15)5-6-13(12)16-9-11-4-2-3-7-19-11/h3,5-8,11,16H,2,4,9H2,1H3
InChIKeyIWCRFTUJKHFAAS-UHFFFAOYSA-N
XLogP2.72
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.28
LogP ≤ 52.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate?
The IUPAC name of methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate (CID 62065809) is methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate.
What is the SMILES notation for methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate?
The canonical SMILES for methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate is COC(=O)c1cc(F)ccc1NCC1CCC=CO1.
What is the InChIKey of methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate?
The InChIKey is IWCRFTUJKHFAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FNO3/c1-18-14(17)12-8-10(15)5-6-13(12)16-9-11-4-2-3-7-19-11/h3,5-8,11,16H,2,4,9H2,1H3.
What are the key properties of methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate?
methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate has a molecular weight of 265.28 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-5-fluorobenzoate is sourced from PubChem (CID 62065809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).