C15H15ClN2O — CID 62066925
8-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)quinolin-5-amine (PubChem CID 62066925) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 8-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)quinolin-5-amine.
| Compound Name | 8-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)quinolin-5-amine |
|---|---|
| PubChem CID | 62066925 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 8-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)quinolin-5-amine |
| SMILES | Clc1ccc(NCC2CCC=CO2)c2cccnc12 |
| InChI | InChI=1S/C15H15ClN2O/c16-13-6-7-14(12-5-3-8-17-15(12)13)18-10-11-4-1-2-9-19-11/h2-3,5-9,11,18H,1,4,10H2 |
| InChIKey | ZIQJCTZIMKGMTM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |