C13H14ClNO3 — CID 62065988
2-chloro-5-(3,4-dihydro-2H-pyran-2-ylmethylamino)benzoic acid (PubChem CID 62065988) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 2-chloro-5-(3,4-dihydro-2H-pyran-2-ylmethylamino)benzoic acid.
| Compound Name | 2-chloro-5-(3,4-dihydro-2H-pyran-2-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 62065988 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-chloro-5-(3,4-dihydro-2H-pyran-2-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NCC2CCC=CO2)ccc1Cl |
| InChI | InChI=1S/C13H14ClNO3/c14-12-5-4-9(7-11(12)13(16)17)15-8-10-3-1-2-6-18-10/h2,4-7,10,15H,1,3,8H2,(H,16,17) |
| InChIKey | LXIOOUKMZIPRGG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |