About 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline
3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline (PubChem CID 62064185) has the molecular formula C12H13Cl2NO
and a molecular weight of 258.15 g/mol. Its IUPAC name is 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline |
| PubChem CID | 62064185 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline |
| SMILES | Clc1ccc(NCC2CCC=CO2)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO/c13-11-5-4-9(7-12(11)14)15-8-10-3-1-2-6-16-10/h2,4-7,10,15H,1,3,8H2 |
| InChIKey | RKWVJLGPUOZNCV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline?
The IUPAC name of 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline (CID 62064185) is 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline.
What is the SMILES notation for 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline?
The canonical SMILES for 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline is Clc1ccc(NCC2CCC=CO2)cc1Cl.
What is the InChIKey of 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline?
The InChIKey is RKWVJLGPUOZNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO/c13-11-5-4-9(7-12(11)14)15-8-10-3-1-2-6-16-10/h2,4-7,10,15H,1,3,8H2.
What are the key properties of 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline?
3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline has a molecular weight of 258.15 g/mol, XLogP of 4.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline is sourced from PubChem (CID 62064185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).