C15H20N2O3 — CID 62066716
3-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)phenoxy]propanamide (PubChem CID 62066716) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)phenoxy]propanamide.
| Compound Name | 3-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)phenoxy]propanamide |
|---|---|
| PubChem CID | 62066716 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-[4-(3,4-dihydro-2H-pyran-2-ylmethylamino)phenoxy]propanamide |
| SMILES | NC(=O)CCOc1ccc(NCC2CCC=CO2)cc1 |
| InChI | InChI=1S/C15H20N2O3/c16-15(18)8-10-20-13-6-4-12(5-7-13)17-11-14-3-1-2-9-19-14/h2,4-7,9,14,17H,1,3,8,10-11H2,(H2,16,18) |
| InChIKey | CDBOTDVEUABDNK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|