C10H13NOS — CID 66350323
N-(3,4-dihydro-2H-pyran-2-ylmethyl)thiophen-3-amine (PubChem CID 66350323) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-2-ylmethyl)thiophen-3-amine.
| Compound Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)thiophen-3-amine |
|---|---|
| PubChem CID | 66350323 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)thiophen-3-amine |
| SMILES | C1=COC(CNc2ccsc2)CC1 |
| InChI | InChI=1S/C10H13NOS/c1-2-5-12-10(3-1)7-11-9-4-6-13-8-9/h2,4-6,8,10-11H,1,3,7H2 |
| InChIKey | ZFQQBBRLCFDOQQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |