About 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol
2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol (PubChem CID 107095013) has the molecular formula C12H17NO2S
and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol |
| PubChem CID | 107095013 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol |
| SMILES | OC(CNCC1CCC=CO1)c1ccsc1 |
| InChI | InChI=1S/C12H17NO2S/c14-12(10-4-6-16-9-10)8-13-7-11-3-1-2-5-15-11/h2,4-6,9,11-14H,1,3,7-8H2 |
| InChIKey | KNPXNSRDLDWSCU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol?
The IUPAC name of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol (CID 107095013) is 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol.
What is the SMILES notation for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol?
The canonical SMILES for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol is OC(CNCC1CCC=CO1)c1ccsc1.
What is the InChIKey of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol?
The InChIKey is KNPXNSRDLDWSCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2S/c14-12(10-4-6-16-9-10)8-13-7-11-3-1-2-5-15-11/h2,4-6,9,11-14H,1,3,7-8H2.
What are the key properties of 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol?
2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol has a molecular weight of 239.34 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-pyran-2-ylmethylamino)-1-thiophen-3-ylethanol is sourced from PubChem (CID 107095013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).