C12H19NO2S — CID 106434859
2-[(5-methyloxolan-2-yl)methylamino]-1-thiophen-3-ylethanol (PubChem CID 106434859) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[(5-methyloxolan-2-yl)methylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(5-methyloxolan-2-yl)methylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106434859 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-[(5-methyloxolan-2-yl)methylamino]-1-thiophen-3-ylethanol |
| SMILES | CC1CCC(CNCC(O)c2ccsc2)O1 |
| InChI | InChI=1S/C12H19NO2S/c1-9-2-3-11(15-9)6-13-7-12(14)10-4-5-16-8-10/h4-5,8-9,11-14H,2-3,6-7H2,1H3 |
| InChIKey | FNBLWDKLTNIRJG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |