C12H13BrClNO — CID 107619335
4-bromo-3-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline (PubChem CID 107619335) has the molecular formula C12H13BrClNO and a molecular weight of 302.60 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline.
| Compound Name | 4-bromo-3-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 107619335 |
| Molecular Formula | C12H13BrClNO |
| Molecular Weight | 302.60 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 4-bromo-3-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)aniline |
| SMILES | Clc1cc(NCC2CCC=CO2)ccc1Br |
| InChI | InChI=1S/C12H13BrClNO/c13-11-5-4-9(7-12(11)14)15-8-10-3-1-2-6-16-10/h2,4-7,10,15H,1,3,8H2 |
| InChIKey | FGWWILBAKXKHGA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |