C15H20ClNO2 — CID 55030643
3-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-4-propoxyaniline (PubChem CID 55030643) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 3-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-4-propoxyaniline.
| Compound Name | 3-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-4-propoxyaniline |
|---|---|
| PubChem CID | 55030643 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-chloro-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-4-propoxyaniline |
| SMILES | CCCOc1ccc(NCC2CCC=CO2)cc1Cl |
| InChI | InChI=1S/C15H20ClNO2/c1-2-8-19-15-7-6-12(10-14(15)16)17-11-13-5-3-4-9-18-13/h4,6-7,9-10,13,17H,2-3,5,8,11H2,1H3 |
| InChIKey | ZZMCXSVGHDDGAO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|