C9H22N2 — CID 62066978
4-methyl-2-N-propan-2-ylpentane-1,2-diamine (PubChem CID 62066978) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is 4-methyl-2-N-propan-2-ylpentane-1,2-diamine.
| Compound Name | 4-methyl-2-N-propan-2-ylpentane-1,2-diamine |
|---|---|
| PubChem CID | 62066978 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 4-methyl-2-N-propan-2-ylpentane-1,2-diamine |
| SMILES | CC(C)CC(CN)NC(C)C |
| InChI | InChI=1S/C9H22N2/c1-7(2)5-9(6-10)11-8(3)4/h7-9,11H,5-6,10H2,1-4H3 |
| InChIKey | QHOKSPHGXSVVEZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |