C15H17FN2O — CID 62073087
N-[[5-fluoro-2-[(6-methyl-3-pyridinyl)oxy]phenyl]methyl]ethanamine (PubChem CID 62073087) has the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. Its IUPAC name is N-[[5-fluoro-2-[(6-methyl-3-pyridinyl)oxy]phenyl]methyl]ethanamine.
| Compound Name | N-[[5-fluoro-2-[(6-methyl-3-pyridinyl)oxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 62073087 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-[[5-fluoro-2-[(6-methyl-3-pyridinyl)oxy]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)ccc1Oc1ccc(C)nc1 |
| InChI | InChI=1S/C15H17FN2O/c1-3-17-9-12-8-13(16)5-7-15(12)19-14-6-4-11(2)18-10-14/h4-8,10,17H,3,9H2,1-2H3 |
| InChIKey | XVHJKZKQHRZTMB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |