C16H19BrN2O2 — CID 62085800
ethyl 2-[1-(4-bromophenyl)-3,5-dimethylpyrazol-4-yl]propanoate (PubChem CID 62085800) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is ethyl 2-[1-(4-bromophenyl)-3,5-dimethylpyrazol-4-yl]propanoate.
| Compound Name | ethyl 2-[1-(4-bromophenyl)-3,5-dimethylpyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 62085800 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | ethyl 2-[1-(4-bromophenyl)-3,5-dimethylpyrazol-4-yl]propanoate |
| SMILES | CCOC(=O)C(C)c1c(C)nn(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C16H19BrN2O2/c1-5-21-16(20)10(2)15-11(3)18-19(12(15)4)14-8-6-13(17)7-9-14/h6-10H,5H2,1-4H3 |
| InChIKey | UQXSSARPWUCELH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |