C10H18N2O2S — CID 62086819
3-amino-N-(2-methoxycyclopentyl)-2-methyl-3-sulfanylidenepropanamide (PubChem CID 62086819) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 3-amino-N-(2-methoxycyclopentyl)-2-methyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(2-methoxycyclopentyl)-2-methyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 62086819 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-amino-N-(2-methoxycyclopentyl)-2-methyl-3-sulfanylidenepropanamide |
| SMILES | COC1CCCC1NC(=O)C(C)C(N)=S |
| InChI | InChI=1S/C10H18N2O2S/c1-6(9(11)15)10(13)12-7-4-3-5-8(7)14-2/h6-8H,3-5H2,1-2H3,(H2,11,15)(H,12,13) |
| InChIKey | OWVLXKKSCRMSOU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|