C8H13F2NO2 — CID 103515439
2,2-difluoro-N-(2-methoxycyclopentyl)acetamide (PubChem CID 103515439) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is 2,2-difluoro-N-(2-methoxycyclopentyl)acetamide.
| Compound Name | 2,2-difluoro-N-(2-methoxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 103515439 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2,2-difluoro-N-(2-methoxycyclopentyl)acetamide |
| SMILES | COC1CCCC1NC(=O)C(F)F |
| InChI | InChI=1S/C8H13F2NO2/c1-13-6-4-2-3-5(6)11-8(12)7(9)10/h5-7H,2-4H2,1H3,(H,11,12) |
| InChIKey | HYGRDDSGVUNPLH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |