C14H14Cl2N2O2 — CID 62087969
[5-(3,5-dichlorophenoxy)-2-propan-2-ylpyrimidin-4-yl]methanol (PubChem CID 62087969) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is [5-(3,5-dichlorophenoxy)-2-propan-2-ylpyrimidin-4-yl]methanol.
| Compound Name | [5-(3,5-dichlorophenoxy)-2-propan-2-ylpyrimidin-4-yl]methanol |
|---|---|
| PubChem CID | 62087969 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | [5-(3,5-dichlorophenoxy)-2-propan-2-ylpyrimidin-4-yl]methanol |
| SMILES | CC(C)c1ncc(Oc2cc(Cl)cc(Cl)c2)c(CO)n1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-8(2)14-17-6-13(12(7-19)18-14)20-11-4-9(15)3-10(16)5-11/h3-6,8,19H,7H2,1-2H3 |
| InChIKey | OZZMIBYMMDNVEM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |